C16H17Cl3N2O3S — CID 17060392
1-[(5-methylfuran-2-yl)methyl]-4-(2,4,5-trichlorophenyl)sulfonylpiperazine (PubChem CID 17060392) has the molecular formula C16H17Cl3N2O3S and a molecular weight of 423.75 g/mol. Its IUPAC name is 1-[(5-methylfuran-2-yl)methyl]-4-(2,4,5-trichlorophenyl)sulfonylpiperazine.
| Compound Name | 1-[(5-methylfuran-2-yl)methyl]-4-(2,4,5-trichlorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 17060392 |
| Molecular Formula | C16H17Cl3N2O3S |
| Molecular Weight | 423.75 g/mol |
| Exact Mass | 422.00 |
| IUPAC Name | 1-[(5-methylfuran-2-yl)methyl]-4-(2,4,5-trichlorophenyl)sulfonylpiperazine |
| SMILES | Cc1ccc(CN2CCN(S(=O)(=O)c3cc(Cl)c(Cl)cc3Cl)CC2)o1 |
| InChI | InChI=1S/C16H17Cl3N2O3S/c1-11-2-3-12(24-11)10-20-4-6-21(7-5-20)25(22,23)16-9-14(18)13(17)8-15(16)19/h2-3,8-9H,4-7,10H2,1H3 |
| InChIKey | JRGUSKPDMGMRDH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.75 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|