C18H19Cl3N2O2S — CID 91669823
1-(2-ethylphenyl)-4-(2,4,5-trichlorophenyl)sulfonylpiperazine (PubChem CID 91669823) has the molecular formula C18H19Cl3N2O2S and a molecular weight of 433.79 g/mol. Its IUPAC name is 1-(2-ethylphenyl)-4-(2,4,5-trichlorophenyl)sulfonylpiperazine.
| Compound Name | 1-(2-ethylphenyl)-4-(2,4,5-trichlorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 91669823 |
| Molecular Formula | C18H19Cl3N2O2S |
| Molecular Weight | 433.79 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 1-(2-ethylphenyl)-4-(2,4,5-trichlorophenyl)sulfonylpiperazine |
| SMILES | CCc1ccccc1N1CCN(S(=O)(=O)c2cc(Cl)c(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C18H19Cl3N2O2S/c1-2-13-5-3-4-6-17(13)22-7-9-23(10-8-22)26(24,25)18-12-15(20)14(19)11-16(18)21/h3-6,11-12H,2,7-10H2,1H3 |
| InChIKey | ILCOHRDGMDLXQU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.79 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|