C15H22N4O3S — CID 17060352
1-(1-ethylpyrazol-4-yl)sulfonyl-4-[(5-methylfuran-2-yl)methyl]piperazine (PubChem CID 17060352) has the molecular formula C15H22N4O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is 1-(1-ethylpyrazol-4-yl)sulfonyl-4-[(5-methylfuran-2-yl)methyl]piperazine.
| Compound Name | 1-(1-ethylpyrazol-4-yl)sulfonyl-4-[(5-methylfuran-2-yl)methyl]piperazine |
|---|---|
| PubChem CID | 17060352 |
| Molecular Formula | C15H22N4O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-(1-ethylpyrazol-4-yl)sulfonyl-4-[(5-methylfuran-2-yl)methyl]piperazine |
| SMILES | CCn1cc(S(=O)(=O)N2CCN(Cc3ccc(C)o3)CC2)cn1 |
| InChI | InChI=1S/C15H22N4O3S/c1-3-18-12-15(10-16-18)23(20,21)19-8-6-17(7-9-19)11-14-5-4-13(2)22-14/h4-5,10,12H,3,6-9,11H2,1-2H3 |
| InChIKey | QWTKQLSQVGICKN-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 71.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |