C23H25F2N5S — CID 17024063
4-[(2,3-difluorophenyl)methyl]-N-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide (PubChem CID 17024063) has the molecular formula C23H25F2N5S and a molecular weight of 441.55 g/mol. Its IUPAC name is 4-[(2,3-difluorophenyl)methyl]-N-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide.
| Compound Name | 4-[(2,3-difluorophenyl)methyl]-N-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17024063 |
| Molecular Formula | C23H25F2N5S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 4-[(2,3-difluorophenyl)methyl]-N-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]piperazine-1-carbothioamide |
| SMILES | Cc1ccccc1Cn1cc(NC(=S)N2CCN(Cc3cccc(F)c3F)CC2)cn1 |
| InChI | InChI=1S/C23H25F2N5S/c1-17-5-2-3-6-18(17)15-30-16-20(13-26-30)27-23(31)29-11-9-28(10-12-29)14-19-7-4-8-21(24)22(19)25/h2-8,13,16H,9-12,14-15H2,1H3,(H,27,31) |
| InChIKey | CDWSIBGYXSAODN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|