C15H21N3O2S — CID 107877007
ethyl 4-[(2-carbamothioylphenyl)methyl]piperazine-1-carboxylate (PubChem CID 107877007) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is ethyl 4-[(2-carbamothioylphenyl)methyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(2-carbamothioylphenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 107877007 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | ethyl 4-[(2-carbamothioylphenyl)methyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(Cc2ccccc2C(N)=S)CC1 |
| InChI | InChI=1S/C15H21N3O2S/c1-2-20-15(19)18-9-7-17(8-10-18)11-12-5-3-4-6-13(12)14(16)21/h3-6H,2,7-11H2,1H3,(H2,16,21) |
| InChIKey | RJJZKKPLYRVKFB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|