C21H25BrN2O4S — CID 46294844
2-[1-(benzenesulfonyl)piperidin-4-yl]-N-[(5-bromo-2-methoxyphenyl)methyl]acetamide (PubChem CID 46294844) has the molecular formula C21H25BrN2O4S and a molecular weight of 481.41 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)piperidin-4-yl]-N-[(5-bromo-2-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[1-(benzenesulfonyl)piperidin-4-yl]-N-[(5-bromo-2-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 46294844 |
| Molecular Formula | C21H25BrN2O4S |
| Molecular Weight | 481.41 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 2-[1-(benzenesulfonyl)piperidin-4-yl]-N-[(5-bromo-2-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(Br)cc1CNC(=O)CC1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H25BrN2O4S/c1-28-20-8-7-18(22)14-17(20)15-23-21(25)13-16-9-11-24(12-10-16)29(26,27)19-5-3-2-4-6-19/h2-8,14,16H,9-13,15H2,1H3,(H,23,25) |
| InChIKey | UANJPQSPOLIANL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |