C24H36N2O3 — CID 997983
1-(2-adamantyl)-4-[(2,4,5-trimethoxyphenyl)methyl]piperazine (PubChem CID 997983) has the molecular formula C24H36N2O3 and a molecular weight of 400.56 g/mol. Its IUPAC name is 1-(2-adamantyl)-4-[(2,4,5-trimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-(2-adamantyl)-4-[(2,4,5-trimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 997983 |
| Molecular Formula | C24H36N2O3 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | 1-(2-adamantyl)-4-[(2,4,5-trimethoxyphenyl)methyl]piperazine |
| SMILES | COc1cc(OC)c(OC)cc1CN1CCN(C2C3CC4CC(C3)CC2C4)CC1 |
| InChI | InChI=1S/C24H36N2O3/c1-27-21-14-23(29-3)22(28-2)13-20(21)15-25-4-6-26(7-5-25)24-18-9-16-8-17(11-18)12-19(24)10-16/h13-14,16-19,24H,4-12,15H2,1-3H3 |
| InChIKey | NEZQAOXFDPNXNT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |