C21H28N4O5S — CID 55838125
2-(2-ethoxyphenoxy)-N-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]acetamide (PubChem CID 55838125) has the molecular formula C21H28N4O5S and a molecular weight of 448.55 g/mol. Its IUPAC name is 2-(2-ethoxyphenoxy)-N-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]acetamide.
| Compound Name | 2-(2-ethoxyphenoxy)-N-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]acetamide |
|---|---|
| PubChem CID | 55838125 |
| Molecular Formula | C21H28N4O5S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 2-(2-ethoxyphenoxy)-N-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]acetamide |
| SMILES | CCOc1ccccc1OCC(=O)NCCS(=O)(=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C21H28N4O5S/c1-2-29-18-7-3-4-8-19(18)30-17-21(26)23-11-16-31(27,28)25-14-12-24(13-15-25)20-9-5-6-10-22-20/h3-10H,2,11-17H2,1H3,(H,23,26) |
| InChIKey | GWOPKNAMZFLZMU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |