C21H27N5O4S — CID 55692362
2-methyl-N-[2-oxo-2-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethylamino]ethyl]benzamide (PubChem CID 55692362) has the molecular formula C21H27N5O4S and a molecular weight of 445.55 g/mol. Its IUPAC name is 2-methyl-N-[2-oxo-2-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethylamino]ethyl]benzamide.
| Compound Name | 2-methyl-N-[2-oxo-2-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 55692362 |
| Molecular Formula | C21H27N5O4S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 2-methyl-N-[2-oxo-2-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethylamino]ethyl]benzamide |
| SMILES | Cc1ccccc1C(=O)NCC(=O)NCCS(=O)(=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C21H27N5O4S/c1-17-6-2-3-7-18(17)21(28)24-16-20(27)23-10-15-31(29,30)26-13-11-25(12-14-26)19-8-4-5-9-22-19/h2-9H,10-16H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | QQCJDVNTSPWFAD-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |