C20H24FN5O4S — CID 46455798
4-fluoro-N-[2-oxo-2-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethylamino]ethyl]benzamide (PubChem CID 46455798) has the molecular formula C20H24FN5O4S and a molecular weight of 449.51 g/mol. Its IUPAC name is 4-fluoro-N-[2-oxo-2-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethylamino]ethyl]benzamide.
| Compound Name | 4-fluoro-N-[2-oxo-2-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 46455798 |
| Molecular Formula | C20H24FN5O4S |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 4-fluoro-N-[2-oxo-2-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethylamino]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(F)cc1)NCCS(=O)(=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C20H24FN5O4S/c21-17-6-4-16(5-7-17)20(28)24-15-19(27)23-9-14-31(29,30)26-12-10-25(11-13-26)18-3-1-2-8-22-18/h1-8H,9-15H2,(H,23,27)(H,24,28) |
| InChIKey | UWQJCGPBRMOFHT-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |