C12H24N2S2 — CID 115880265
1-(3,3-dimethylcyclopentyl)-3-(3-methylsulfanylpropyl)thiourea (PubChem CID 115880265) has the molecular formula C12H24N2S2 and a molecular weight of 260.47 g/mol. Its IUPAC name is 1-(3,3-dimethylcyclopentyl)-3-(3-methylsulfanylpropyl)thiourea.
| Compound Name | 1-(3,3-dimethylcyclopentyl)-3-(3-methylsulfanylpropyl)thiourea |
|---|---|
| PubChem CID | 115880265 |
| Molecular Formula | C12H24N2S2 |
| Molecular Weight | 260.47 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 1-(3,3-dimethylcyclopentyl)-3-(3-methylsulfanylpropyl)thiourea |
| SMILES | CSCCCNC(=S)NC1CCC(C)(C)C1 |
| InChI | InChI=1S/C12H24N2S2/c1-12(2)6-5-10(9-12)14-11(15)13-7-4-8-16-3/h10H,4-9H2,1-3H3,(H2,13,14,15) |
| InChIKey | XRFQGKSBBRIPOF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|