C13H27NO — CID 104537039
6-[(3,3-dimethylcyclopentyl)amino]hexan-1-ol (PubChem CID 104537039) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is 6-[(3,3-dimethylcyclopentyl)amino]hexan-1-ol.
| Compound Name | 6-[(3,3-dimethylcyclopentyl)amino]hexan-1-ol |
|---|---|
| PubChem CID | 104537039 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 6-[(3,3-dimethylcyclopentyl)amino]hexan-1-ol |
| SMILES | CC1(C)CCC(NCCCCCCO)C1 |
| InChI | InChI=1S/C13H27NO/c1-13(2)8-7-12(11-13)14-9-5-3-4-6-10-15/h12,14-15H,3-11H2,1-2H3 |
| InChIKey | QXJCQUMDJFRVKM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|