C15H31NO — CID 114008759
6-[(4,4-dimethylcycloheptyl)amino]hexan-1-ol (PubChem CID 114008759) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is 6-[(4,4-dimethylcycloheptyl)amino]hexan-1-ol.
| Compound Name | 6-[(4,4-dimethylcycloheptyl)amino]hexan-1-ol |
|---|---|
| PubChem CID | 114008759 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | 6-[(4,4-dimethylcycloheptyl)amino]hexan-1-ol |
| SMILES | CC1(C)CCCC(NCCCCCCO)CC1 |
| InChI | InChI=1S/C15H31NO/c1-15(2)10-7-8-14(9-11-15)16-12-5-3-4-6-13-17/h14,16-17H,3-13H2,1-2H3 |
| InChIKey | JITCXTVTUKFJSZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|