C11H22N2OS — CID 115880253
1-(3,3-dimethylcyclopentyl)-3-(2-methoxyethyl)thiourea (PubChem CID 115880253) has the molecular formula C11H22N2OS and a molecular weight of 230.38 g/mol. Its IUPAC name is 1-(3,3-dimethylcyclopentyl)-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-(3,3-dimethylcyclopentyl)-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 115880253 |
| Molecular Formula | C11H22N2OS |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 1-(3,3-dimethylcyclopentyl)-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)NC1CCC(C)(C)C1 |
| InChI | InChI=1S/C11H22N2OS/c1-11(2)5-4-9(8-11)13-10(15)12-6-7-14-3/h9H,4-8H2,1-3H3,(H2,12,13,15) |
| InChIKey | FOBVEVIOMQMZSZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|