C16H23F2N3O2S3 — CID 43077027
1-[4-(difluoromethylsulfanyl)phenyl]-3-(1-propylsulfonylpiperidin-4-yl)thiourea (PubChem CID 43077027) has the molecular formula C16H23F2N3O2S3 and a molecular weight of 423.58 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfanyl)phenyl]-3-(1-propylsulfonylpiperidin-4-yl)thiourea.
| Compound Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-(1-propylsulfonylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 43077027 |
| Molecular Formula | C16H23F2N3O2S3 |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-(1-propylsulfonylpiperidin-4-yl)thiourea |
| SMILES | CCCS(=O)(=O)N1CCC(NC(=S)Nc2ccc(SC(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H23F2N3O2S3/c1-2-11-26(22,23)21-9-7-13(8-10-21)20-16(24)19-12-3-5-14(6-4-12)25-15(17)18/h3-6,13,15H,2,7-11H2,1H3,(H2,19,20,24) |
| InChIKey | HXSTUIYURVBDIY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|