C15H22F2N2S — CID 43673068
N-[4-(difluoromethylsulfanyl)phenyl]-1-propylpiperidin-4-amine (PubChem CID 43673068) has the molecular formula C15H22F2N2S and a molecular weight of 300.42 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-1-propylpiperidin-4-amine.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-1-propylpiperidin-4-amine |
|---|---|
| PubChem CID | 43673068 |
| Molecular Formula | C15H22F2N2S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-1-propylpiperidin-4-amine |
| SMILES | CCCN1CCC(Nc2ccc(SC(F)F)cc2)CC1 |
| InChI | InChI=1S/C15H22F2N2S/c1-2-9-19-10-7-13(8-11-19)18-12-3-5-14(6-4-12)20-15(16)17/h3-6,13,15,18H,2,7-11H2,1H3 |
| InChIKey | BBIOSJQRAVLLKB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |