C21H16N4O4S — CID 1120366
3-(2,5-dioxopyrrolidin-1-yl)-N-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]benzamide (PubChem CID 1120366) has the molecular formula C21H16N4O4S and a molecular weight of 420.45 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)-N-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]benzamide.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 1120366 |
| Molecular Formula | C21H16N4O4S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C(=O)Nc2nccs2)cc1)c1cccc(N2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C21H16N4O4S/c26-17-8-9-18(27)25(17)16-3-1-2-14(12-16)20(29)23-15-6-4-13(5-7-15)19(28)24-21-22-10-11-30-21/h1-7,10-12H,8-9H2,(H,23,29)(H,22,24,28) |
| InChIKey | KVZVLLDJXXSGKK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|