C21H17N3O2S — CID 26175588
(E)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 26175588) has the molecular formula C21H17N3O2S and a molecular weight of 375.45 g/mol. Its IUPAC name is (E)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 26175588 |
| Molecular Formula | C21H17N3O2S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | (E)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccc(-c3cn4ccsc4n3)cc2)cc1 |
| InChI | InChI=1S/C21H17N3O2S/c1-26-18-9-2-15(3-10-18)4-11-20(25)22-17-7-5-16(6-8-17)19-14-24-12-13-27-21(24)23-19/h2-14H,1H3,(H,22,25)/b11-4+ |
| InChIKey | QOQQTUOXATUDNO-NYYWCZLTSA-N |
| XLogP | 4.72 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|