C19H21Cl2N3O4S — CID 25479876
(2S)-2-acetamido-N-[4-chloro-3-[(2-chlorophenyl)sulfamoyl]phenyl]-3-methylbutanamide (PubChem CID 25479876) has the molecular formula C19H21Cl2N3O4S and a molecular weight of 458.37 g/mol. Its IUPAC name is (2S)-2-acetamido-N-[4-chloro-3-[(2-chlorophenyl)sulfamoyl]phenyl]-3-methylbutanamide.
| Compound Name | (2S)-2-acetamido-N-[4-chloro-3-[(2-chlorophenyl)sulfamoyl]phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 25479876 |
| Molecular Formula | C19H21Cl2N3O4S |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | (2S)-2-acetamido-N-[4-chloro-3-[(2-chlorophenyl)sulfamoyl]phenyl]-3-methylbutanamide |
| SMILES | CC(=O)N[C@H](C(=O)Nc1ccc(Cl)c(S(=O)(=O)Nc2ccccc2Cl)c1)C(C)C |
| InChI | InChI=1S/C19H21Cl2N3O4S/c1-11(2)18(22-12(3)25)19(26)23-13-8-9-15(21)17(10-13)29(27,28)24-16-7-5-4-6-14(16)20/h4-11,18,24H,1-3H3,(H,22,25)(H,23,26)/t18-/m0/s1 |
| InChIKey | FPMYVZCDZWTTRW-SFHVURJKSA-N |
| XLogP | 3.89 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |