C26H28N4O3S — CID 170416918
(2S)-3-methyl-2-[1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl-(quinolin-8-ylcarbamothioyl)amino]butanoic acid (PubChem CID 170416918) has the molecular formula C26H28N4O3S and a molecular weight of 476.60 g/mol. Its IUPAC name is (2S)-3-methyl-2-[1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl-(quinolin-8-ylcarbamothioyl)amino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl-(quinolin-8-ylcarbamothioyl)amino]butanoic acid |
|---|---|
| PubChem CID | 170416918 |
| Molecular Formula | C26H28N4O3S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | (2S)-3-methyl-2-[1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl-(quinolin-8-ylcarbamothioyl)amino]butanoic acid |
| SMILES | CC(C)[C@@H](C(=O)O)N(C(=S)Nc1cccc2cccnc12)C(C)NC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C26H28N4O3S/c1-17(2)24(25(32)33)30(18(3)28-22(31)15-14-19-9-5-4-6-10-19)26(34)29-21-13-7-11-20-12-8-16-27-23(20)21/h4-18,24H,1-3H3,(H,28,31)(H,29,34)(H,32,33)/b15-14+/t18?,24-/m0/s1 |
| InChIKey | LSTYFGWTQMQMJY-RYPWLATASA-N |
| XLogP | 4.52 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|