C24H21Cl3N4O3S — CID 158364359
[N-quinolin-8-yl-N'-[2,2,2-trichloro-1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]carbamimidoyl]sulfanylmethyl acetate (PubChem CID 158364359) has the molecular formula C24H21Cl3N4O3S and a molecular weight of 551.88 g/mol. Its IUPAC name is [N-quinolin-8-yl-N'-[2,2,2-trichloro-1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]carbamimidoyl]sulfanylmethyl acetate.
| Compound Name | [N-quinolin-8-yl-N'-[2,2,2-trichloro-1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]carbamimidoyl]sulfanylmethyl acetate |
|---|---|
| PubChem CID | 158364359 |
| Molecular Formula | C24H21Cl3N4O3S |
| Molecular Weight | 551.88 g/mol |
| Exact Mass | 550.04 |
| IUPAC Name | [N-quinolin-8-yl-N'-[2,2,2-trichloro-1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]carbamimidoyl]sulfanylmethyl acetate |
| SMILES | CC(=O)OCSC(=NC(NC(=O)/C=C/c1ccccc1)C(Cl)(Cl)Cl)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C24H21Cl3N4O3S/c1-16(32)34-15-35-23(29-19-11-5-9-18-10-6-14-28-21(18)19)31-22(24(25,26)27)30-20(33)13-12-17-7-3-2-4-8-17/h2-14,22H,15H2,1H3,(H,29,31)(H,30,33)/b13-12+ |
| InChIKey | GTVQTSRGKMYIEZ-OUKQBFOZSA-N |
| XLogP | 5.78 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.88 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|