C26H27Cl3N4O3S2 — CID 160864090
(2S)-3-methyl-2-[quinolin-8-ylcarbamothioyl-[2,2,2-trichloro-1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]amino]butanoic acid;sulfane (PubChem CID 160864090) has the molecular formula C26H27Cl3N4O3S2 and a molecular weight of 614.02 g/mol. Its IUPAC name is (2S)-3-methyl-2-[quinolin-8-ylcarbamothioyl-[2,2,2-trichloro-1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]amino]butanoic acid;sulfane.
| Compound Name | (2S)-3-methyl-2-[quinolin-8-ylcarbamothioyl-[2,2,2-trichloro-1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]amino]butanoic acid;sulfane |
|---|---|
| PubChem CID | 160864090 |
| Molecular Formula | C26H27Cl3N4O3S2 |
| Molecular Weight | 614.02 g/mol |
| Exact Mass | 612.06 |
| IUPAC Name | (2S)-3-methyl-2-[quinolin-8-ylcarbamothioyl-[2,2,2-trichloro-1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]amino]butanoic acid;sulfane |
| SMILES | CC(C)[C@@H](C(=O)O)N(C(=S)Nc1cccc2cccnc12)C(NC(=O)/C=C/c1ccccc1)C(Cl)(Cl)Cl.S |
| InChI | InChI=1S/C26H25Cl3N4O3S.H2S/c1-16(2)22(23(35)36)33(25(37)31-19-12-6-10-18-11-7-15-30-21(18)19)24(26(27,28)29)32-20(34)14-13-17-8-4-3-5-9-17;/h3-16,22,24H,1-2H3,(H,31,37)(H,32,34)(H,35,36);1H2/b14-13+;/t22-,24?;/m0./s1 |
| InChIKey | SKWKBIKAJHUUDH-JTADTBNDSA-N |
| XLogP | 5.98 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.02 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|