C30H26Cl3N5O2S — CID 139519231
(2S)-2-amino-3-phenyl-N-(quinolin-8-ylcarbamothioyl)-N-[2,2,2-trichloro-1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]propanamide (PubChem CID 139519231) has the molecular formula C30H26Cl3N5O2S and a molecular weight of 627.00 g/mol. Its IUPAC name is (2S)-2-amino-3-phenyl-N-(quinolin-8-ylcarbamothioyl)-N-[2,2,2-trichloro-1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]propanamide.
| Compound Name | (2S)-2-amino-3-phenyl-N-(quinolin-8-ylcarbamothioyl)-N-[2,2,2-trichloro-1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 139519231 |
| Molecular Formula | C30H26Cl3N5O2S |
| Molecular Weight | 627.00 g/mol |
| Exact Mass | 625.09 |
| IUPAC Name | (2S)-2-amino-3-phenyl-N-(quinolin-8-ylcarbamothioyl)-N-[2,2,2-trichloro-1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]propanamide |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N(C(=S)Nc1cccc2cccnc12)C(NC(=O)/C=C/c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C30H26Cl3N5O2S/c31-30(32,33)28(37-25(39)17-16-20-9-3-1-4-10-20)38(27(40)23(34)19-21-11-5-2-6-12-21)29(41)36-24-15-7-13-22-14-8-18-35-26(22)24/h1-18,23,28H,19,34H2,(H,36,41)(H,37,39)/b17-16+/t23-,28?/m0/s1 |
| InChIKey | YHPBVCJFUMVRKF-FZASYNMTSA-N |
| XLogP | 5.86 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.00 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|