C26H23Cl3N4O4S — CID 139519155
methyl 4-oxo-4-[quinolin-8-ylcarbamothioyl-[2,2,2-trichloro-1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]amino]butanoate (PubChem CID 139519155) has the molecular formula C26H23Cl3N4O4S and a molecular weight of 593.92 g/mol. Its IUPAC name is methyl 4-oxo-4-[quinolin-8-ylcarbamothioyl-[2,2,2-trichloro-1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]amino]butanoate.
| Compound Name | methyl 4-oxo-4-[quinolin-8-ylcarbamothioyl-[2,2,2-trichloro-1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]amino]butanoate |
|---|---|
| PubChem CID | 139519155 |
| Molecular Formula | C26H23Cl3N4O4S |
| Molecular Weight | 593.92 g/mol |
| Exact Mass | 592.05 |
| IUPAC Name | methyl 4-oxo-4-[quinolin-8-ylcarbamothioyl-[2,2,2-trichloro-1-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]amino]butanoate |
| SMILES | COC(=O)CCC(=O)N(C(=S)Nc1cccc2cccnc12)C(NC(=O)/C=C/c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C26H23Cl3N4O4S/c1-37-22(36)15-14-21(35)33(25(38)31-19-11-5-9-18-10-6-16-30-23(18)19)24(26(27,28)29)32-20(34)13-12-17-7-3-2-4-8-17/h2-13,16,24H,14-15H2,1H3,(H,31,38)(H,32,34)/b13-12+ |
| InChIKey | IIIHYJLHBNJSGL-OUKQBFOZSA-N |
| XLogP | 5.24 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.92 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|