C20H19Cl3N3OSe — CID 161116119
CID 161116119 (PubChem CID 161116119) has the molecular formula C20H19Cl3N3OSe and a molecular weight of 502.71 g/mol.
| Compound Name | CID 161116119 |
|---|---|
| PubChem CID | 161116119 |
| Molecular Formula | C20H19Cl3N3OSe |
| Molecular Weight | 502.71 g/mol |
| Exact Mass | 501.98 |
| IUPAC Name | — |
| SMILES | Cc1cccc(NC([Se])=NC(NC(=O)/C=C/c2ccccc2)C(Cl)(Cl)Cl)c1C |
| InChI | InChI=1S/C20H19Cl3N3OSe/c1-13-7-6-10-16(14(13)2)24-19(28)26-18(20(21,22)23)25-17(27)12-11-15-8-4-3-5-9-15/h3-12,18H,1-2H3,(H,24,26)(H,25,27)/b12-11+ |
| InChIKey | LRWAUSAAOKUJPE-VAWYXSNFSA-N |
| XLogP | 4.77 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.71 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|