C18H14BrCl3N3OSe — CID 152964799
CID 152964799 (PubChem CID 152964799) has the molecular formula C18H14BrCl3N3OSe and a molecular weight of 553.55 g/mol.
| Compound Name | CID 152964799 |
|---|---|
| PubChem CID | 152964799 |
| Molecular Formula | C18H14BrCl3N3OSe |
| Molecular Weight | 553.55 g/mol |
| Exact Mass | 551.86 |
| IUPAC Name | — |
| SMILES | O=C(/C=C/c1ccccc1)NC(N=C([Se])Nc1ccc(Br)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H14BrCl3N3OSe/c19-13-7-9-14(10-8-13)23-17(27)25-16(18(20,21)22)24-15(26)11-6-12-4-2-1-3-5-12/h1-11,16H,(H,23,25)(H,24,26)/b11-6+ |
| InChIKey | JVVPSBCDJBHUOL-IZZDOVSWSA-N |
| XLogP | 4.91 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|