C21H24Cl3N3O2S — CID 2282761
2-(4-ethylphenoxy)-N-[(1R)-2,2,2-trichloro-1-[(2,4-dimethylphenyl)carbamothioylamino]ethyl]acetamide (PubChem CID 2282761) has the molecular formula C21H24Cl3N3O2S and a molecular weight of 488.87 g/mol. Its IUPAC name is 2-(4-ethylphenoxy)-N-[(1R)-2,2,2-trichloro-1-[(2,4-dimethylphenyl)carbamothioylamino]ethyl]acetamide.
| Compound Name | 2-(4-ethylphenoxy)-N-[(1R)-2,2,2-trichloro-1-[(2,4-dimethylphenyl)carbamothioylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 2282761 |
| Molecular Formula | C21H24Cl3N3O2S |
| Molecular Weight | 488.87 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | 2-(4-ethylphenoxy)-N-[(1R)-2,2,2-trichloro-1-[(2,4-dimethylphenyl)carbamothioylamino]ethyl]acetamide |
| SMILES | CCc1ccc(OCC(=O)N[C@H](NC(=S)Nc2ccc(C)cc2C)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C21H24Cl3N3O2S/c1-4-15-6-8-16(9-7-15)29-12-18(28)26-19(21(22,23)24)27-20(30)25-17-10-5-13(2)11-14(17)3/h5-11,19H,4,12H2,1-3H3,(H,26,28)(H2,25,27,30)/t19-/m1/s1 |
| InChIKey | GQWBXOYZCDSIJC-LJQANCHMSA-N |
| XLogP | 5.04 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.87 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|