C21H21Cl3N4OS — CID 178128213
3-phenyl-N-[2,2,2-trichloro-1-[(1-methylindol-7-yl)carbamothioylamino]ethyl]propanamide (PubChem CID 178128213) has the molecular formula C21H21Cl3N4OS and a molecular weight of 483.85 g/mol. Its IUPAC name is 3-phenyl-N-[2,2,2-trichloro-1-[(1-methylindol-7-yl)carbamothioylamino]ethyl]propanamide.
| Compound Name | 3-phenyl-N-[2,2,2-trichloro-1-[(1-methylindol-7-yl)carbamothioylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 178128213 |
| Molecular Formula | C21H21Cl3N4OS |
| Molecular Weight | 483.85 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | 3-phenyl-N-[2,2,2-trichloro-1-[(1-methylindol-7-yl)carbamothioylamino]ethyl]propanamide |
| SMILES | Cn1ccc2cccc(NC(=S)NC(NC(=O)CCc3ccccc3)C(Cl)(Cl)Cl)c21 |
| InChI | InChI=1S/C21H21Cl3N4OS/c1-28-13-12-15-8-5-9-16(18(15)28)25-20(30)27-19(21(22,23)24)26-17(29)11-10-14-6-3-2-4-7-14/h2-9,12-13,19H,10-11H2,1H3,(H,26,29)(H2,25,27,30) |
| InChIKey | VVRIXSQCZLLYNX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 58.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.85 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|