C16H20Cl3N4ORbS — CID 178128131
3-phenyl-N-[2,2,2-trichloro-1-(piperazin-4-ide-1-carbothioylamino)ethyl]propanamide;rubidium(1+) (PubChem CID 178128131) has the molecular formula C16H20Cl3N4ORbS and a molecular weight of 508.26 g/mol. Its IUPAC name is 3-phenyl-N-[2,2,2-trichloro-1-(piperazin-4-ide-1-carbothioylamino)ethyl]propanamide;rubidium(1+).
| Compound Name | 3-phenyl-N-[2,2,2-trichloro-1-(piperazin-4-ide-1-carbothioylamino)ethyl]propanamide;rubidium(1+) |
|---|---|
| PubChem CID | 178128131 |
| Molecular Formula | C16H20Cl3N4ORbS |
| Molecular Weight | 508.26 g/mol |
| Exact Mass | 505.95 |
| IUPAC Name | 3-phenyl-N-[2,2,2-trichloro-1-(piperazin-4-ide-1-carbothioylamino)ethyl]propanamide;rubidium(1+) |
| SMILES | O=C(CCc1ccccc1)NC(NC(=S)N1CC[N-]CC1)C(Cl)(Cl)Cl.[Rb+] |
| InChI | InChI=1S/C16H20Cl3N4OS.Rb/c17-16(18,19)14(22-15(25)23-10-8-20-9-11-23)21-13(24)7-6-12-4-2-1-3-5-12;/h1-5,14H,6-11H2,(H,21,24)(H,22,25);/q-1;+1 |
| InChIKey | VINQACCACRDTMK-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 58.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.26 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|