C21H17BrCl3N3OS — CID 2259904
N-[(1S)-1-[(3-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-2-naphthalen-1-ylacetamide (PubChem CID 2259904) has the molecular formula C21H17BrCl3N3OS and a molecular weight of 545.72 g/mol. Its IUPAC name is N-[(1S)-1-[(3-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[(1S)-1-[(3-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 2259904 |
| Molecular Formula | C21H17BrCl3N3OS |
| Molecular Weight | 545.72 g/mol |
| Exact Mass | 542.93 |
| IUPAC Name | N-[(1S)-1-[(3-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-2-naphthalen-1-ylacetamide |
| SMILES | O=C(Cc1cccc2ccccc12)N[C@@H](NC(=S)Nc1cccc(Br)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C21H17BrCl3N3OS/c22-15-8-4-9-16(12-15)26-20(30)28-19(21(23,24)25)27-18(29)11-14-7-3-6-13-5-1-2-10-17(13)14/h1-10,12,19H,11H2,(H,27,29)(H2,26,28,30)/t19-/m0/s1 |
| InChIKey | GBBBEJHFRCWUIR-IBGZPJMESA-N |
| XLogP | 5.94 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.72 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|