C22H19Cl3N4O4S — CID 9499773
2-naphthalen-1-yl-N-[(1R)-2,2,2-trichloro-1-[(4-methoxy-2-nitrophenyl)carbamothioylamino]ethyl]acetamide (PubChem CID 9499773) has the molecular formula C22H19Cl3N4O4S and a molecular weight of 541.84 g/mol. Its IUPAC name is 2-naphthalen-1-yl-N-[(1R)-2,2,2-trichloro-1-[(4-methoxy-2-nitrophenyl)carbamothioylamino]ethyl]acetamide.
| Compound Name | 2-naphthalen-1-yl-N-[(1R)-2,2,2-trichloro-1-[(4-methoxy-2-nitrophenyl)carbamothioylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 9499773 |
| Molecular Formula | C22H19Cl3N4O4S |
| Molecular Weight | 541.84 g/mol |
| Exact Mass | 540.02 |
| IUPAC Name | 2-naphthalen-1-yl-N-[(1R)-2,2,2-trichloro-1-[(4-methoxy-2-nitrophenyl)carbamothioylamino]ethyl]acetamide |
| SMILES | COc1ccc(NC(=S)N[C@@H](NC(=O)Cc2cccc3ccccc23)C(Cl)(Cl)Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H19Cl3N4O4S/c1-33-15-9-10-17(18(12-15)29(31)32)26-21(34)28-20(22(23,24)25)27-19(30)11-14-7-4-6-13-5-2-3-8-16(13)14/h2-10,12,20H,11H2,1H3,(H,27,30)(H2,26,28,34)/t20-/m1/s1 |
| InChIKey | DXWDBLHGAREIBD-HXUWFJFHSA-N |
| XLogP | 5.10 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.84 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|