C28H30Cl3N5O4S2 — CID 18839663
4-tert-butyl-N-[2,2,2-trichloro-1-[[2-[[(4-methylphenyl)sulfonylamino]carbamoyl]phenyl]carbamothioylamino]ethyl]benzamide (PubChem CID 18839663) has the molecular formula C28H30Cl3N5O4S2 and a molecular weight of 671.07 g/mol. Its IUPAC name is 4-tert-butyl-N-[2,2,2-trichloro-1-[[2-[[(4-methylphenyl)sulfonylamino]carbamoyl]phenyl]carbamothioylamino]ethyl]benzamide.
| Compound Name | 4-tert-butyl-N-[2,2,2-trichloro-1-[[2-[[(4-methylphenyl)sulfonylamino]carbamoyl]phenyl]carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 18839663 |
| Molecular Formula | C28H30Cl3N5O4S2 |
| Molecular Weight | 671.07 g/mol |
| Exact Mass | 669.08 |
| IUPAC Name | 4-tert-butyl-N-[2,2,2-trichloro-1-[[2-[[(4-methylphenyl)sulfonylamino]carbamoyl]phenyl]carbamothioylamino]ethyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)NNC(=O)c2ccccc2NC(=S)NC(NC(=O)c2ccc(C(C)(C)C)cc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C28H30Cl3N5O4S2/c1-17-9-15-20(16-10-17)42(39,40)36-35-24(38)21-7-5-6-8-22(21)32-26(41)34-25(28(29,30)31)33-23(37)18-11-13-19(14-12-18)27(2,3)4/h5-16,25,36H,1-4H3,(H,33,37)(H,35,38)(H2,32,34,41) |
| InChIKey | GJWAXEDSCJWXKC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 128.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.07 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|