C24H21BrCl3N5O4S2 — CID 4659009
2-bromo-N-[2,2,2-trichloro-1-[[2-[[(4-methylphenyl)sulfonylamino]carbamoyl]phenyl]carbamothioylamino]ethyl]benzamide (PubChem CID 4659009) has the molecular formula C24H21BrCl3N5O4S2 and a molecular weight of 693.86 g/mol. Its IUPAC name is 2-bromo-N-[2,2,2-trichloro-1-[[2-[[(4-methylphenyl)sulfonylamino]carbamoyl]phenyl]carbamothioylamino]ethyl]benzamide.
| Compound Name | 2-bromo-N-[2,2,2-trichloro-1-[[2-[[(4-methylphenyl)sulfonylamino]carbamoyl]phenyl]carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 4659009 |
| Molecular Formula | C24H21BrCl3N5O4S2 |
| Molecular Weight | 693.86 g/mol |
| Exact Mass | 690.93 |
| IUPAC Name | 2-bromo-N-[2,2,2-trichloro-1-[[2-[[(4-methylphenyl)sulfonylamino]carbamoyl]phenyl]carbamothioylamino]ethyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)NNC(=O)c2ccccc2NC(=S)NC(NC(=O)c2ccccc2Br)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C24H21BrCl3N5O4S2/c1-14-10-12-15(13-11-14)39(36,37)33-32-21(35)17-7-3-5-9-19(17)29-23(38)31-22(24(26,27)28)30-20(34)16-6-2-4-8-18(16)25/h2-13,22,33H,1H3,(H,30,34)(H,32,35)(H2,29,31,38) |
| InChIKey | XBBFABDTLMQTOB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 128.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.86 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|