C23H22ClNO2 — CID 28580247
(2S)-2-(4-chlorophenoxy)-N-[(R)-(4-methylphenyl)-phenylmethyl]propanamide (PubChem CID 28580247) has the molecular formula C23H22ClNO2 and a molecular weight of 379.89 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenoxy)-N-[(R)-(4-methylphenyl)-phenylmethyl]propanamide.
| Compound Name | (2S)-2-(4-chlorophenoxy)-N-[(R)-(4-methylphenyl)-phenylmethyl]propanamide |
|---|---|
| PubChem CID | 28580247 |
| Molecular Formula | C23H22ClNO2 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | (2S)-2-(4-chlorophenoxy)-N-[(R)-(4-methylphenyl)-phenylmethyl]propanamide |
| SMILES | Cc1ccc([C@H](NC(=O)[C@H](C)Oc2ccc(Cl)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H22ClNO2/c1-16-8-10-19(11-9-16)22(18-6-4-3-5-7-18)25-23(26)17(2)27-21-14-12-20(24)13-15-21/h3-15,17,22H,1-2H3,(H,25,26)/t17-,22+/m0/s1 |
| InChIKey | WCRQXBXMSTUVDQ-HTAPYJJXSA-N |
| XLogP | 5.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |