C27H31NO2 — CID 28572482
(2S)-2-(4-tert-butylphenoxy)-N-[(R)-(4-methylphenyl)-phenylmethyl]propanamide (PubChem CID 28572482) has the molecular formula C27H31NO2 and a molecular weight of 401.55 g/mol. Its IUPAC name is (2S)-2-(4-tert-butylphenoxy)-N-[(R)-(4-methylphenyl)-phenylmethyl]propanamide.
| Compound Name | (2S)-2-(4-tert-butylphenoxy)-N-[(R)-(4-methylphenyl)-phenylmethyl]propanamide |
|---|---|
| PubChem CID | 28572482 |
| Molecular Formula | C27H31NO2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | (2S)-2-(4-tert-butylphenoxy)-N-[(R)-(4-methylphenyl)-phenylmethyl]propanamide |
| SMILES | Cc1ccc([C@H](NC(=O)[C@H](C)Oc2ccc(C(C)(C)C)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H31NO2/c1-19-11-13-22(14-12-19)25(21-9-7-6-8-10-21)28-26(29)20(2)30-24-17-15-23(16-18-24)27(3,4)5/h6-18,20,25H,1-5H3,(H,28,29)/t20-,25+/m0/s1 |
| InChIKey | WUIPTYVCIGOPPY-NBGIEHNGSA-N |
| XLogP | 5.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |