C21H26N2O4 — CID 132512694
tert-butyl 4-(phenylmethoxycarbonylamino)-4-pyridin-4-ylbutanoate (PubChem CID 132512694) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is tert-butyl 4-(phenylmethoxycarbonylamino)-4-pyridin-4-ylbutanoate.
| Compound Name | tert-butyl 4-(phenylmethoxycarbonylamino)-4-pyridin-4-ylbutanoate |
|---|---|
| PubChem CID | 132512694 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | tert-butyl 4-(phenylmethoxycarbonylamino)-4-pyridin-4-ylbutanoate |
| SMILES | CC(C)(C)OC(=O)CCC(NC(=O)OCc1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C21H26N2O4/c1-21(2,3)27-19(24)10-9-18(17-11-13-22-14-12-17)23-20(25)26-15-16-7-5-4-6-8-16/h4-8,11-14,18H,9-10,15H2,1-3H3,(H,23,25) |
| InChIKey | XVTFKFJGNZZSIB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |