C31H34N2O6Si — CID 101457357
methyl 2-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-(phenylmethoxycarbonylamino)ethyl]-1,3-oxazole-4-carboxylate (PubChem CID 101457357) has the molecular formula C31H34N2O6Si and a molecular weight of 558.71 g/mol. Its IUPAC name is methyl 2-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-(phenylmethoxycarbonylamino)ethyl]-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-(phenylmethoxycarbonylamino)ethyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 101457357 |
| Molecular Formula | C31H34N2O6Si |
| Molecular Weight | 558.71 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | methyl 2-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-(phenylmethoxycarbonylamino)ethyl]-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)c1coc([C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)NC(=O)OCc2ccccc2)n1 |
| InChI | InChI=1S/C31H34N2O6Si/c1-31(2,3)40(24-16-10-6-11-17-24,25-18-12-7-13-19-25)39-22-26(28-32-27(21-37-28)29(34)36-4)33-30(35)38-20-23-14-8-5-9-15-23/h5-19,21,26H,20,22H2,1-4H3,(H,33,35)/t26-/m0/s1 |
| InChIKey | QQHAMIBNQXTITD-SANMLTNESA-N |
| XLogP | 5.01 |
| TPSA | 99.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.71 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|