About benzyl 2-triphenylsilylacetate
benzyl 2-triphenylsilylacetate (PubChem CID 134956777) has the molecular formula C27H24O2Si
and a molecular weight of 408.57 g/mol. Its IUPAC name is benzyl 2-triphenylsilylacetate.
Molecular Properties
| Compound Name | benzyl 2-triphenylsilylacetate |
| PubChem CID | 134956777 |
| Molecular Formula | C27H24O2Si |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | benzyl 2-triphenylsilylacetate |
| SMILES | O=C(C[Si](c1ccccc1)(c1ccccc1)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C27H24O2Si/c28-27(29-21-23-13-5-1-6-14-23)22-30(24-15-7-2-8-16-24,25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20H,21-22H2 |
| InChIKey | XUCIZDHWMPJIGC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-triphenylsilylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-triphenylsilylacetate?
The IUPAC name of benzyl 2-triphenylsilylacetate (CID 134956777) is benzyl 2-triphenylsilylacetate.
What is the SMILES notation for benzyl 2-triphenylsilylacetate?
The canonical SMILES for benzyl 2-triphenylsilylacetate is O=C(C[Si](c1ccccc1)(c1ccccc1)c1ccccc1)OCc1ccccc1.
What is the InChIKey of benzyl 2-triphenylsilylacetate?
The InChIKey is XUCIZDHWMPJIGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24O2Si/c28-27(29-21-23-13-5-1-6-14-23)22-30(24-15-7-2-8-16-24,25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20H,21-22H2.
What are the key properties of benzyl 2-triphenylsilylacetate?
benzyl 2-triphenylsilylacetate has a molecular weight of 408.57 g/mol, XLogP of 3.90, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-triphenylsilylacetate is sourced from PubChem (CID 134956777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).