C19H28O7S — CID 175182985
2-[2-[3-(4-methylphenyl)sulfonyloxypropoxy]propoxy]propyl prop-2-enoate (PubChem CID 175182985) has the molecular formula C19H28O7S and a molecular weight of 400.49 g/mol. Its IUPAC name is 2-[2-[3-(4-methylphenyl)sulfonyloxypropoxy]propoxy]propyl prop-2-enoate.
| Compound Name | 2-[2-[3-(4-methylphenyl)sulfonyloxypropoxy]propoxy]propyl prop-2-enoate |
|---|---|
| PubChem CID | 175182985 |
| Molecular Formula | C19H28O7S |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2-[2-[3-(4-methylphenyl)sulfonyloxypropoxy]propoxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)OCC(C)OCCCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H28O7S/c1-5-19(20)25-14-17(4)24-13-16(3)23-11-6-12-26-27(21,22)18-9-7-15(2)8-10-18/h5,7-10,16-17H,1,6,11-14H2,2-4H3 |
| InChIKey | YZUAGGANGHHNEG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|