C18H26O8S — CID 175190868
1-[1-[1-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethyl prop-2-enoate (PubChem CID 175190868) has the molecular formula C18H26O8S and a molecular weight of 402.47 g/mol. Its IUPAC name is 1-[1-[1-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethyl prop-2-enoate.
| Compound Name | 1-[1-[1-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 175190868 |
| Molecular Formula | C18H26O8S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 1-[1-[1-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)OC(C)OC(C)OCCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H26O8S/c1-6-18(19)26-16(5)25-15(4)24-14(3)22-11-12-23-27(20,21)17-9-7-13(2)8-10-17/h6-10,14-16H,1,11-12H2,2-5H3 |
| InChIKey | ZRFXWGVDEGRZHM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|