C31H24ClN7O14S4 — CID 136674679
1-amino-4-[3-[[6-chloro-4-[4-(2-sulfooxyethylsulfonyl)anilino]-1H-1,3,5-triazin-2-ylidene]amino]-4-sulfoanilino]-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 136674679) has the molecular formula C31H24ClN7O14S4 and a molecular weight of 882.29 g/mol. Its IUPAC name is 1-amino-4-[3-[[6-chloro-4-[4-(2-sulfooxyethylsulfonyl)anilino]-1H-1,3,5-triazin-2-ylidene]amino]-4-sulfoanilino]-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 1-amino-4-[3-[[6-chloro-4-[4-(2-sulfooxyethylsulfonyl)anilino]-1H-1,3,5-triazin-2-ylidene]amino]-4-sulfoanilino]-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 136674679 |
| Molecular Formula | C31H24ClN7O14S4 |
| Molecular Weight | 882.29 g/mol |
| Exact Mass | 881.00 |
| IUPAC Name | 1-amino-4-[3-[[6-chloro-4-[4-(2-sulfooxyethylsulfonyl)anilino]-1H-1,3,5-triazin-2-ylidene]amino]-4-sulfoanilino]-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | Nc1c(S(=O)(=O)O)cc(Nc2ccc(S(=O)(=O)O)c(/N=c3\nc(Nc4ccc(S(=O)(=O)CCOS(=O)(=O)O)cc4)nc(Cl)[nH]3)c2)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C31H24ClN7O14S4/c32-29-37-30(35-15-5-8-17(9-6-15)54(42,43)12-11-53-57(50,51)52)39-31(38-29)36-20-13-16(7-10-22(20)55(44,45)46)34-21-14-23(56(47,48)49)26(33)25-24(21)27(40)18-3-1-2-4-19(18)28(25)41/h1-10,13-14,34H,11-12,33H2,(H,44,45,46)(H,47,48,49)(H,50,51,52)(H2,35,36,37,38,39) |
| InChIKey | PBTWNLIOBPXINR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 344.63 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|