C25H23N4NaO11S3 — CID 173428602
sodium;3-[[6-ethoxy-5-hydroxy-8-[(2-methylsulfonyl-4-nitrophenyl)diazenyl]naphthalen-1-yl]sulfamoyl]benzenesulfonic acid;hydride (PubChem CID 173428602) has the molecular formula C25H23N4NaO11S3 and a molecular weight of 674.67 g/mol. Its IUPAC name is sodium;3-[[6-ethoxy-5-hydroxy-8-[(2-methylsulfonyl-4-nitrophenyl)diazenyl]naphthalen-1-yl]sulfamoyl]benzenesulfonic acid;hydride.
| Compound Name | sodium;3-[[6-ethoxy-5-hydroxy-8-[(2-methylsulfonyl-4-nitrophenyl)diazenyl]naphthalen-1-yl]sulfamoyl]benzenesulfonic acid;hydride |
|---|---|
| PubChem CID | 173428602 |
| Molecular Formula | C25H23N4NaO11S3 |
| Molecular Weight | 674.67 g/mol |
| Exact Mass | 674.04 |
| IUPAC Name | sodium;3-[[6-ethoxy-5-hydroxy-8-[(2-methylsulfonyl-4-nitrophenyl)diazenyl]naphthalen-1-yl]sulfamoyl]benzenesulfonic acid;hydride |
| SMILES | CCOc1cc(/N=N/c2ccc([N+](=O)[O-])cc2S(C)(=O)=O)c2c(NS(=O)(=O)c3cccc(S(=O)(=O)O)c3)cccc2c1O.[H-].[Na+] |
| InChI | InChI=1S/C25H22N4O11S3.Na.H/c1-3-40-22-14-21(27-26-19-11-10-15(29(31)32)12-23(19)41(2,33)34)24-18(25(22)30)8-5-9-20(24)28-42(35,36)16-6-4-7-17(13-16)43(37,38)39;;/h4-14,28,30H,3H2,1-2H3,(H,37,38,39);;/q;+1;-1/b27-26+;; |
| InChIKey | LHJOCXDJUSRTQC-YOYNBWDYSA-N |
| XLogP | 1.84 |
| TPSA | 232.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.67 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|