C24H21N3O5S2 — CID 158582080
N-[5-hydroxy-8-[(2-methyl-4-methylsulfonylphenyl)diazenyl]naphthalen-1-yl]benzenesulfonamide (PubChem CID 158582080) has the molecular formula C24H21N3O5S2 and a molecular weight of 495.58 g/mol. Its IUPAC name is N-[5-hydroxy-8-[(2-methyl-4-methylsulfonylphenyl)diazenyl]naphthalen-1-yl]benzenesulfonamide.
| Compound Name | N-[5-hydroxy-8-[(2-methyl-4-methylsulfonylphenyl)diazenyl]naphthalen-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 158582080 |
| Molecular Formula | C24H21N3O5S2 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | N-[5-hydroxy-8-[(2-methyl-4-methylsulfonylphenyl)diazenyl]naphthalen-1-yl]benzenesulfonamide |
| SMILES | Cc1cc(S(C)(=O)=O)ccc1/N=N/c1ccc(O)c2cccc(NS(=O)(=O)c3ccccc3)c12 |
| InChI | InChI=1S/C24H21N3O5S2/c1-16-15-18(33(2,29)30)11-12-20(16)25-26-21-13-14-23(28)19-9-6-10-22(24(19)21)27-34(31,32)17-7-4-3-5-8-17/h3-15,27-28H,1-2H3/b26-25+ |
| InChIKey | HTJJIDUPPFCCKE-OCEACIFDSA-N |
| XLogP | 5.47 |
| TPSA | 125.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|