C24H21N3O10S4 — CID 135675134
3-[[8-[[2,4-bis(methylsulfonyl)phenyl]diazenyl]-5-hydroxynaphthalen-1-yl]sulfamoyl]benzenesulfonic acid (PubChem CID 135675134) has the molecular formula C24H21N3O10S4 and a molecular weight of 639.71 g/mol. Its IUPAC name is 3-[[8-[[2,4-bis(methylsulfonyl)phenyl]diazenyl]-5-hydroxynaphthalen-1-yl]sulfamoyl]benzenesulfonic acid.
| Compound Name | 3-[[8-[[2,4-bis(methylsulfonyl)phenyl]diazenyl]-5-hydroxynaphthalen-1-yl]sulfamoyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 135675134 |
| Molecular Formula | C24H21N3O10S4 |
| Molecular Weight | 639.71 g/mol |
| Exact Mass | 639.01 |
| IUPAC Name | 3-[[8-[[2,4-bis(methylsulfonyl)phenyl]diazenyl]-5-hydroxynaphthalen-1-yl]sulfamoyl]benzenesulfonic acid |
| SMILES | CS(=O)(=O)c1ccc(/N=N/c2ccc(O)c3cccc(NS(=O)(=O)c4cccc(S(=O)(=O)O)c4)c23)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C24H21N3O10S4/c1-38(29,30)15-9-10-19(23(14-15)39(2,31)32)25-26-20-11-12-22(28)18-7-4-8-21(24(18)20)27-40(33,34)16-5-3-6-17(13-16)41(35,36)37/h3-14,27-28H,1-2H3,(H,35,36,37)/b26-25+ |
| InChIKey | LHFMJPMGWRTHQW-OCEACIFDSA-N |
| XLogP | 3.82 |
| TPSA | 213.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.71 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|