C19H15N5Na2O11S2 — CID 170854100
CID 170854100 (PubChem CID 170854100) has the molecular formula C19H15N5Na2O11S2 and a molecular weight of 599.47 g/mol.
| Compound Name | CID 170854100 |
|---|---|
| PubChem CID | 170854100 |
| Molecular Formula | C19H15N5Na2O11S2 |
| Molecular Weight | 599.47 g/mol |
| Exact Mass | 599.00 |
| IUPAC Name | — |
| SMILES | COc1ccc(S(=O)(=O)O)cc1/N=N/c1cc(/N=N/c2ccc([N+](=O)[O-])cc2S(=O)(=O)O)c(O)cc1O.[Na].[Na] |
| InChI | InChI=1S/C19H15N5O11S2.2Na/c1-35-18-5-3-11(36(29,30)31)7-15(18)23-22-14-8-13(16(25)9-17(14)26)21-20-12-4-2-10(24(27)28)6-19(12)37(32,33)34;;/h2-9,25-26H,1H3,(H,29,30,31)(H,32,33,34);;/b21-20+,23-22+;; |
| InChIKey | YZHBGJFRDSZWGI-RRLHDRTRSA-N |
| XLogP | 3.58 |
| TPSA | 251.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|