C20H22N4O11S — CID 59372677
2-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]-5-nitrobenzenesulfonic acid (PubChem CID 59372677) has the molecular formula C20H22N4O11S and a molecular weight of 526.48 g/mol. Its IUPAC name is 2-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]-5-nitrobenzenesulfonic acid.
| Compound Name | 2-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]-5-nitrobenzenesulfonic acid |
|---|---|
| PubChem CID | 59372677 |
| Molecular Formula | C20H22N4O11S |
| Molecular Weight | 526.48 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | 2-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]-5-nitrobenzenesulfonic acid |
| SMILES | CC(=O)OCCOc1cc(/N=N/c2ccc([N+](=O)[O-])cc2S(=O)(=O)O)c(OCCOC(C)=O)cc1N |
| InChI | InChI=1S/C20H22N4O11S/c1-12(25)32-5-7-34-18-11-17(19(10-15(18)21)35-8-6-33-13(2)26)23-22-16-4-3-14(24(27)28)9-20(16)36(29,30)31/h3-4,9-11H,5-8,21H2,1-2H3,(H,29,30,31)/b23-22+ |
| InChIKey | WNYBTAAEQXXHBL-GHVJWSGMSA-N |
| XLogP | 2.72 |
| TPSA | 219.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|