About 2-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]-5-nitrobenzenesulfonic acid
2-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]-5-nitrobenzenesulfonic acid (PubChem CID 59372677) has the molecular formula C20H22N4O11S
and a molecular weight of 526.48 g/mol. Its IUPAC name is 2-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]-5-nitrobenzenesulfonic acid.
Molecular Properties
| Compound Name | 2-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]-5-nitrobenzenesulfonic acid |
| PubChem CID | 59372677 |
| Molecular Formula | C20H22N4O11S |
| Molecular Weight | 526.48 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | 2-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]-5-nitrobenzenesulfonic acid |
| SMILES | CC(=O)OCCOc1cc(/N=N/c2ccc([N+](=O)[O-])cc2S(=O)(=O)O)c(OCCOC(C)=O)cc1N |
| InChI | InChI=1S/C20H22N4O11S/c1-12(25)32-5-7-34-18-11-17(19(10-15(18)21)35-8-6-33-13(2)26)23-22-16-4-3-14(24(27)28)9-20(16)36(29,30)31/h3-4,9-11H,5-8,21H2,1-2H3,(H,29,30,31)/b23-22+ |
| InChIKey | WNYBTAAEQXXHBL-GHVJWSGMSA-N |
| XLogP | 2.72 |
| TPSA | 219.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]-5-nitrobenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]-5-nitrobenzenesulfonic acid?
The IUPAC name of 2-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]-5-nitrobenzenesulfonic acid (CID 59372677) is 2-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]-5-nitrobenzenesulfonic acid.
What is the SMILES notation for 2-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]-5-nitrobenzenesulfonic acid?
The canonical SMILES for 2-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]-5-nitrobenzenesulfonic acid is CC(=O)OCCOc1cc(/N=N/c2ccc([N+](=O)[O-])cc2S(=O)(=O)O)c(OCCOC(C)=O)cc1N.
What is the InChIKey of 2-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]-5-nitrobenzenesulfonic acid?
The InChIKey is WNYBTAAEQXXHBL-GHVJWSGMSA-N. The full InChI is InChI=1S/C20H22N4O11S/c1-12(25)32-5-7-34-18-11-17(19(10-15(18)21)35-8-6-33-13(2)26)23-22-16-4-3-14(24(27)28)9-20(16)36(29,30)31/h3-4,9-11H,5-8,21H2,1-2H3,(H,29,30,31)/b23-22+.
What are the key properties of 2-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]-5-nitrobenzenesulfonic acid?
2-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]-5-nitrobenzenesulfonic acid has a molecular weight of 526.48 g/mol, XLogP of 2.72, 12 rotatable bonds, 2 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,5-bis(2-acetyloxyethoxy)-4-aminophenyl]diazenyl]-5-nitrobenzenesulfonic acid is sourced from PubChem (CID 59372677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).