C16H14N4O6 — CID 90476065
methyl 3-[(2,4-dinitrophenyl)diazenyl]-3-phenylpropanoate (PubChem CID 90476065) has the molecular formula C16H14N4O6 and a molecular weight of 358.31 g/mol. Its IUPAC name is methyl 3-[(2,4-dinitrophenyl)diazenyl]-3-phenylpropanoate.
| Compound Name | methyl 3-[(2,4-dinitrophenyl)diazenyl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 90476065 |
| Molecular Formula | C16H14N4O6 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | methyl 3-[(2,4-dinitrophenyl)diazenyl]-3-phenylpropanoate |
| SMILES | COC(=O)CC(/N=N/c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C16H14N4O6/c1-26-16(21)10-14(11-5-3-2-4-6-11)18-17-13-8-7-12(19(22)23)9-15(13)20(24)25/h2-9,14H,10H2,1H3/b18-17+ |
| InChIKey | NOJTVTWFHOSGBU-ISLYRVAYSA-N |
| XLogP | 3.89 |
| TPSA | 137.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|