C18H18N2O5 — CID 40856389
methyl (3S)-3-[[2-(2-nitrophenyl)acetyl]amino]-3-phenylpropanoate (PubChem CID 40856389) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is methyl (3S)-3-[[2-(2-nitrophenyl)acetyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (3S)-3-[[2-(2-nitrophenyl)acetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 40856389 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | methyl (3S)-3-[[2-(2-nitrophenyl)acetyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)C[C@H](NC(=O)Cc1ccccc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C18H18N2O5/c1-25-18(22)12-15(13-7-3-2-4-8-13)19-17(21)11-14-9-5-6-10-16(14)20(23)24/h2-10,15H,11-12H2,1H3,(H,19,21)/t15-/m0/s1 |
| InChIKey | VRUNJWFVKOPSHK-HNNXBMFYSA-N |
| XLogP | 2.56 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|