C19H22N2O5 — CID 132653987
N-[1-(3,4-dimethoxyphenyl)propyl]-2-(2-nitrophenyl)acetamide (PubChem CID 132653987) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)propyl]-2-(2-nitrophenyl)acetamide.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)propyl]-2-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 132653987 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)propyl]-2-(2-nitrophenyl)acetamide |
| SMILES | CCC(NC(=O)Cc1ccccc1[N+](=O)[O-])c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H22N2O5/c1-4-15(13-9-10-17(25-2)18(11-13)26-3)20-19(22)12-14-7-5-6-8-16(14)21(23)24/h5-11,15H,4,12H2,1-3H3,(H,20,22) |
| InChIKey | ZZCUJXNJGRSGHA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|