C20H23N3O3 — CID 42948492
2-(2-nitrophenyl)-N-(1-phenyl-2-pyrrolidin-1-ylethyl)acetamide (PubChem CID 42948492) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 2-(2-nitrophenyl)-N-(1-phenyl-2-pyrrolidin-1-ylethyl)acetamide.
| Compound Name | 2-(2-nitrophenyl)-N-(1-phenyl-2-pyrrolidin-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 42948492 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 2-(2-nitrophenyl)-N-(1-phenyl-2-pyrrolidin-1-ylethyl)acetamide |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])NC(CN1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C20H23N3O3/c24-20(14-17-10-4-5-11-19(17)23(25)26)21-18(15-22-12-6-7-13-22)16-8-2-1-3-9-16/h1-5,8-11,18H,6-7,12-15H2,(H,21,24) |
| InChIKey | DFSJENLFJUKTKN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|